Molecule Details
| InChIKey | KKYABQBFGDZVNQ-UHFFFAOYSA-N |
|---|---|
| Compound Name | Losmapimod |
| Canonical SMILES | Cc1c(F)cc(C(=O)NC2CC2)cc1-c1ccc(C(=O)NCC(C)(C)C)cn1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.68 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12270 |
|---|---|
| Drug Name | Losmapimod |
| CAS Number | 585543-15-3 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Losmapimod has been investigated for the prevention of Chronic Obstructive Pulmonary Disease. |
Categories: Cycloparaffins Protein Kinase Inhibitors p38 Mitogen-Activated Protein Kinases
Cross-references: BindingDB: 50418610 ChEBI: 131167 CHEMBL1088752 ChemSpider: 9727484 PubChem:11552706 PubChem:347828541 Wikipedia: Losmapimod ZINC: ZINC000035793138
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q9Y6E0 | STK24 | Homo sapiens | Human | PF20929 PF00069 | 8.0 | Kd | ChEMBL |
| Q15759 | MAPK11 | Homo sapiens | Human | PF00069 | 7.6 | Ki | ChEMBL;BindingDB |
| Q16539 | MAPK14 | Homo sapiens | Human | PF00069 | 7.6 | Ki | ChEMBL;BindingDB |
| P49137 | MAPKAPK2 | Homo sapiens | Human | PF00069 | 7.6 | Kd | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q16539 | MAPK14 | Mitogen-activated protein kinase 14 | inhibitor | targets |