Molecule Details
| InChIKey | KCWZGJVSDFYRIX-YFKPBYRVSA-N |
|---|---|
| Compound Name | NG-nitro-L-arginine methyl ester |
| Canonical SMILES | COC(=O)[C@@H](N)CCCNC(=N)N[N+](=O)[O-] |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.25 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12750 |
|---|---|
| Drug Name | N-omega-nitro-L-arginine methyl ester |
| CAS Number | 50903-99-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | L-NAME has been investigated for the treatment of Hypotension and Spinal Cord Injury. |
Categories: Amino Acids Amino Acids, Basic Amino Acids, Diamino Amino Acids, Peptides, and Proteins Arginine Enzyme Inhibitors
Cross-references: BindingDB: 50098937 ChEBI: 7549 CHEMBL7890 ChemSpider: 36427 C04337 PubChem:39836 PubChem:347828939 ZINC: ZINC000015987659
Target Activities (3)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P29475 | NOS1 | Homo sapiens | Human | PF00667 PF00258 PF00175 PF02898 PF00595 | 6.5 | IC50 | ChEMBL;BindingDB |
| P29474 | NOS3 | Homo sapiens | Human | PF00667 PF00258 PF00175 PF02898 | 6.2 | IC50 | ChEMBL;BindingDB |
| P35228 | NOS2 | Homo sapiens | Human | PF00667 PF00258 PF00175 PF02898 | 6.1 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P29474 | NOS3 | Nitric oxide synthase 3 | inhibitor | targets |