Molecule Details
| InChIKey | KCTFTBCZZUBAKN-UHFFFAOYSA-N |
|---|---|
| Compound Name | Pratosartan |
| Canonical SMILES | CCCc1nc2c(n1Cc1ccc(-c3ccccc3-c3nnn[nH]3)cc1)C(=O)CCCC2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 10.04 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20100 |
|---|---|
| Drug Name | Pratosartan |
| CAS Number | 153804-05-8 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Pratosartan is a small molecule drug. The usage of the INN stem '-sartan' in the name indicates that Pratosartan is a angiotensin II receptor antagonist, antihypertensive (non-peptidic). Pratosartan has a monoisotopic molecular weight of 426.22 Da. |
Cross-references: BindingDB: 50049188 ChEBI: 32041 CHEMBL41194 ZINC: ZINC000003786304
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P30556 | AGTR1 | Type-1 angiotensin II receptor | antagonist | targets |