Molecule Details
| InChIKey | JZQKKSLKJUAGIC-UHFFFAOYSA-N |
|---|---|
| Compound Name | Pindolol |
| Canonical SMILES | CC(C)NCC(O)COc1cccc2[nH]ccc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.69 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00960 |
|---|---|
| Drug Name | Pindolol |
| CAS Number | 13523-86-9 |
| Groups | approved investigational |
| ATC Codes | C07CA03 C07AA03 |
| Description | Pindolol is a first generation non-selective beta blocker used in the treatment of hypertension.[L32353] Early research into the use of pindolol found it had chronotropic effects, and so further investigation focused on the treatment of arrhythmia.[A231059] Research into pindolol's use in the treatm... |
Categories: Adrenergic Agents Adrenergic Antagonists Adrenergic beta-Antagonists Agents causing hyperkalemia Alcohols Amines Amino Alcohols Antidepressive Agents Antihypertensive Agents Antihypertensive Agents Indicated for Hypertension Beta Blocking Agents, Non-Selective Bradycardia-Causing Agents Cardiovascular Agents Central Nervous System Depressants Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (weak) Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs that are Mainly Renally Excreted Hypotensive Agents Neurotransmitter Agents OCT2 Substrates Phenoxypropanolamines Propanolamines Propanols Serotonergic Drugs Shown to Increase Risk of Serotonin Syndrome Serotonin 5-HT1 Receptor Antagonists Serotonin 5-HT1A Receptor Antagonists Serotonin Agents Serotonin Receptor Antagonists Vasodilating Agents
Cross-references: BindingDB: 50019443 ChEBI: 8214 CHEMBL500 ChemSpider: 4662 Drugs Product Database (DPD): 2144 Guide to Pharmacology: 91 IUPHAR: 91 C07445 D00513 PharmGKB: PA450966 PubChem:4828 PubChem:46508362 RxCUI: 8332 Therapeutic Targets Database: DAP000025 Wikipedia: Pindolol
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P07550 | ADRB2 | Homo sapiens | Human | PF00001 | 9.3 | Ki | ChEMBL;BindingDB |
| P08588 | ADRB1 | Homo sapiens | Human | PF00001 | 8.7 | Ki | ChEMBL;BindingDB |
| P08908 | HTR1A | Homo sapiens | Human | PF00001 | 7.5 | Ki | ChEMBL;BindingDB |
| P13945 | ADRB3 | Homo sapiens | Human | PF00001 | 7.1 | Kd | ChEMBL;BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 6.0 | Ki | ChEMBL |
DrugBank Target Actions (11)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | alpha1-acid glycoprotein | binder | carriers |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | inhibitor | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | substrate | enzymes |
| P22309 | UGT1A1 | UDP-glucuronosyltransferases (UGTs) | substrate | enzymes |
| P50225 | SULT1A1 | Sulfotransferase | substrate | enzymes |
| P13945 | ADRB3 | Beta-3 adrenergic receptor | agonist | targets |
| P08908 | HTR1A | 5-hydroxytryptamine receptor 1A | antagonist | targets |
| P28222 | HTR1B | 5-hydroxytryptamine receptor 1B | antagonist | targets |
| P07550 | ADRB2 | Beta-2 adrenergic receptor | partial agonist | targets |
| P08588 | ADRB1 | Beta-1 adrenergic receptor | partial agonist | targets |
| O15244 | SLC22A2 | Solute carrier family 22 member 2 | substrate | transporters |