Molecule Details
| InChIKey | JXZZEXZZKAWDSP-UHFFFAOYSA-N |
|---|---|
| Compound Name | Indoramin |
| Canonical SMILES | O=C(NC1CCN(CCc2c[nH]c3ccccc23)CC1)c1ccccc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.11 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB08950 |
|---|---|
| Drug Name | Indoramin |
| CAS Number | 26844-12-2 |
| Groups | approved withdrawn |
| ATC Codes | C02CA02 |
| Description | Indoramin is a discontinued piperidine antiadrenergic drug with the trade names Baratol and Doralese. It is a selective alpha-1 adrenergic antagonist with no reflex tachycardia and direct myocardial depression action. |
Categories: Acids, Carbocyclic Adrenergic Agents Adrenergic Antagonists Adrenergic alpha-1 Receptor Antagonists Adrenergic alpha-Antagonists Agents that produce hypertension Amides Antiadrenergic Agents, Peripherally Acting Antihypertensive Agents Benzamides and benzamide derivatives Benzene Derivatives Benzoates Cardiovascular Agents Heterocyclic Compounds, Fused-Ring Hypotensive Agents Indoles Neurotransmitter Agents Peripheral alpha-1 blockers Piperidines
Cross-references: BindingDB: 50033113 ChEBI: 135470 CHEMBL279516 ChemSpider: 31014 D04531 PubChem:33625 PubChem:310264915 RxCUI: 5784 Wikipedia: Indoramin ZINC: ZINC000000001567
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 8.4 | Ki | ChEMBL;BindingDB |
| P35368 | ADRA1B | Homo sapiens | Human | PF00001 | 7.6 | Ki | ChEMBL;BindingDB |
| P25100 | ADRA1D | Homo sapiens | Human | PF00001 | 7.0 | Ki | ChEMBL;BindingDB |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL;BindingDB |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 6.3 | Ki | ChEMBL;BindingDB |