Molecule Details
| InChIKey | JXLYSJRDGCGARV-CFWMRBGOSA-N |
|---|---|
| Compound Name | Vinblastine |
| Canonical SMILES | CC[C@]1(O)C[C@@H]2CN(CCc3c([nH]c4ccccc34)[C@@](C(=O)OC)(c3cc4c(cc3OC)N(C)[C@H]3[C@@](O)(C(=O)OC)[C@H](OC(C)=O)[C@]5(CC)C=CCN6CC[C@]43[C@@H]65)C2)C1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 17 |
| Pfam Stratification | Unknown |
| Avg pChEMBL | 6.84 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00570 |
|---|---|
| Drug Name | Vinblastine |
| CAS Number | 865-21-4 |
| Groups | approved investigational |
| ATC Codes | L01CA01 |
| Description | Antitumor alkaloid isolated from Vinca rosea. (Merck, 11th ed.) |
Categories: Alkaloids Antimitotic Agents Antineoplastic Agents Antineoplastic Agents, Phytogenic Antineoplastic and Immunomodulating Agents BSEP/ABCB11 Inhibitors BSEP/ABCB11 Substrates BSEP/ABCB11 Substrates with a Narrow Therapeutic Index Cardiotoxic antineoplastic agents Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (weak) Cytochrome P-450 CYP3A Inducers Cytochrome P-450 CYP3A Inhibitors Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Inducers Cytochrome P-450 CYP3A4 Inducers (strength unknown) Cytochrome P-450 CYP3A4 Inhibitors Cytochrome P-450 CYP3A4 Inhibitors (strength unknown) Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A4 Substrates with a Narrow Therapeutic Index Cytochrome P-450 Enzyme Inducers Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Cytotoxins Heterocyclic Compounds, Fused-Ring Immunosuppressive Agents Indole Alkaloids Indoles Indolizidines Indolizines Mitosis Modulators Myelosuppressive Agents Narrow Therapeutic Index Drugs OATP1B1/SLCO1B1 Inhibitors P-glycoprotein inducers P-glycoprotein inhibitors P-glycoprotein substrates P-glycoprotein substrates with a Narrow Therapeutic Index Secologanin Tryptamine Alkaloids Tubulin Modulators Vinca Alkaloids
Cross-references: BindingDB: 50012278 CHEMBL159 ChemSpider: 12773 Drugs Product Database (DPD): 9407 PDB: VLB PharmGKB: PA451877 PubChem:13342 PubChem:46504550 RxCUI: 11198 Therapeutic Targets Database: DAP000785 Wikipedia: Vinblastine ZINC: ZINC000085432544
Target Activities (17)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P08183 | ABCB1 | Homo sapiens | Human | PF00664 PF00005 | 7.0 | Ki | ChEMBL;BindingDB |
| P04350 | TUBB4A | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| P07437 | TUBB | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| P0DPH7 | TUBA3C | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| P68363 | TUBA1B | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| P68366 | TUBA4A | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| P68371 | TUBB4B | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| Q13509 | TUBB3 | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| Q13885 | TUBB2A | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| Q3ZCM7 | TUBB8 | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| Q6PEY2 | TUBA3E | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| Q71U36 | TUBA1A | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| Q9BQE3 | TUBA1C | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| Q9BUF5 | TUBB6 | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| Q9BVA1 | TUBB2B | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| Q9H4B7 | TUBB1 | Homo sapiens | Human | PF00091 PF03953 | 6.9 | IC50 | ChEMBL |
| Q25270 | beta-tubulin | Leishmania donovani | Pathogen | — | 6.0 | IC50 | ChEMBL |
DrugBank Target Actions (24)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inducer | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inhibitor | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | inhibitor | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P07437 | TUBB | Tubulin beta chain | binder | targets |
| P23258 | P23258 | Tubulin gamma-1 chain | binder | targets |
| Q71U36 | TUBA1A | Tubulin alpha-1A chain | binder | targets |
| Q9UJT0 | Q9UJT0 | Tubulin epsilon chain | binder | targets |
| Q9UJT1 | Q9UJT1 | Tubulin delta chain | binder | targets |
| Q13885 | TUBB2A | Tubulin beta-2A chain | inhibitor | targets |
| P05412 | JUN | Transcription factor Jun | other/unknown | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inducer | transporters |
| P33527 | ABCC1 | Multidrug resistance-associated protein 1 | inducer | transporters |
| Q92887 | ABCC2 | ATP-binding cassette sub-family C member 2 | inducer | transporters |
| O95255 | O95255 | ATP-binding cassette sub-family C member 6 | inhibitor | transporters |
| O95342 | ABCB11 | Bile salt export pump | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inhibitor | transporters |
| P33527 | ABCC1 | Multidrug resistance-associated protein 1 | inhibitor | transporters |
| Q92887 | ABCC2 | ATP-binding cassette sub-family C member 2 | inhibitor | transporters |
| Q9Y6L6 | SLCO1B1 | Solute carrier organic anion transporter family member 1B1 | inhibitor | transporters |
| O95342 | ABCB11 | Bile salt export pump | substrate | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |
| P33527 | ABCC1 | Multidrug resistance-associated protein 1 | substrate | transporters |
| Q92887 | ABCC2 | ATP-binding cassette sub-family C member 2 | substrate | transporters |