Molecule Details
| InChIKey | JWYIGNODXSRKGP-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | CC(=O)Nc1cccc2c1c(Sc1ccc(Cl)cc1)c(C)n2CC(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.23 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11946 |
|---|---|
| Drug Name | AZD-1981 |
| CAS Number | 802904-66-1 |
| Groups | investigational |
| ATC Codes | nan |
| Description | AZD1981 has been used in trials studying the treatment and basic science of Asthma, Postmenopausal, Pharmakokinetic, Asthma Patients, and Drug Interaction, among others. |
Cross-references: BindingDB: 50357102 CHEMBL1914489 ChemSpider: 9467177 PubChem:11292191 PubChem:347828272 ZINC: ZINC000073196066
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q9Y5Y4 | PTGDR2 | Prostaglandin D2 receptor 2 | antagonist | targets |