Molecule Details
| InChIKey | JWHAUXFOSRPERK-UHFFFAOYSA-N |
|---|---|
| Compound Name | Propafenone |
| Canonical SMILES | CCCNCC(O)COc1ccccc1C(=O)CCc1ccccc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 9 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.59 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB01182 |
|---|---|
| Drug Name | Propafenone |
| CAS Number | 54063-53-5 |
| Groups | approved investigational |
| ATC Codes | C01BC03 |
| Description | An antiarrhythmia agent that is particularly effective in ventricular arrhythmias. It also has weak beta-blocking activity. The drug is generally well tolerated. |
Categories: Adrenergic Antagonists Adrenergic beta-Antagonists Agents causing hyperkalemia Agents that produce hypertension Antiarrhythmic agents Antiarrhythmics, Class I Antiarrhythmics, Class Ic Bradycardia-Causing Agents Cardiac Therapy Cardiovascular Agents Cytochrome P-450 CYP1A2 Inhibitors Cytochrome P-450 CYP1A2 Inhibitors (strength unknown) Cytochrome P-450 CYP1A2 Substrates Cytochrome P-450 CYP2D6 Inhibitors Cytochrome P-450 CYP2D6 Inhibitors (strong) Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Ketones Membrane Transport Modulators Moderate Risk QTc-Prolonging Agents P-glycoprotein inhibitors Propiophenones QTc Prolonging Agents Sodium Channel Blockers Voltage-Gated Sodium Channel Blockers
Cross-references: BindingDB: 50067133 ChEBI: 63619 CHEMBL631 ChemSpider: 4763 Drugs Product Database (DPD): 1893 Guide to Pharmacology: 2561 IUPHAR: 2561 C07381 D08435 PharmGKB: PA451131 PubChem:4932 PubChem:46504529 RxCUI: 8754 Therapeutic Targets Database: DAP000497 Wikipedia: Propafenone
Target Activities (9)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P07550 | ADRB2 | Homo sapiens | Human | PF00001 | 7.4 | IC50 | ChEMBL |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 7.1 | IC50 | ChEMBL |
| P08588 | ADRB1 | Homo sapiens | Human | PF00001 | 6.6 | IC50 | ChEMBL |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 6.6 | IC50 | ChEMBL |
| P08183 | ABCB1 | Homo sapiens | Human | PF00664 PF00005 | 6.5 | IC50 | ChEMBL;BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 6.5 | IC50 | ChEMBL |
| P13945 | ADRB3 | Homo sapiens | Human | PF00001 | 6.4 | IC50 | ChEMBL |
| Q12809 | KCNH2 | Homo sapiens | Human | PF00027 PF00520 PF13426 | 6.2 | IC50 | ChEMBL;BindingDB |
| P50406 | HTR6 | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL |
DrugBank Target Actions (10)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P05177 | CYP1A2 | Cytochrome P450 1A2 | inhibitor | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | inhibitor | enzymes |
| P05177 | CYP1A2 | Cytochrome P450 1A2 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P10635 | CYP2D6 | Cytochrome P450 2D6 | substrate | enzymes |
| P07550 | ADRB2 | Beta-2 adrenergic receptor | antagonist | targets |
| P08588 | ADRB1 | Beta-1 adrenergic receptor | antagonist | targets |
| Q12809 | KCNH2 | Voltage-gated inwardly rectifying potassium channel KCNH2 | inhibitor | targets |
| Q14524 | SCN5A | Sodium channel protein type 5 subunit alpha | inhibitor | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inhibitor | transporters |