Molecule Details
| InChIKey | JWBOIMRXGHLCPP-UHFFFAOYSA-N |
|---|---|
| Compound Name | Mitotane |
| Canonical SMILES | Clc1ccc(C(c2ccccc2Cl)C(Cl)Cl)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.11 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00648 |
|---|---|
| Drug Name | Mitotane |
| CAS Number | 53-19-0 |
| Groups | approved investigational |
| ATC Codes | L01XX23 |
| Description | Mitotane is an adrenolytic isomer of the insecticide dichlorodiphenyldichloroethane (DDD) - itself a metabolite of dichlorodiphenyltrichloroethane (DDT) - that inhibits cells of the adrenal cortex and their production of hormones. It has been in use since 1959 for the treatment of inoperable adrenoc... |
Categories: Adrenal Cytotoxic Agents Antineoplastic Agents Antineoplastic Agents, Hormonal Antineoplastic and Immunomodulating Agents Cytochrome P-450 CYP3A Inducers Cytochrome P-450 CYP3A Inducers (strong) Cytochrome P-450 CYP3A4 Inducers Cytochrome P-450 CYP3A4 Inducers (strong) Cytochrome P-450 CYP3A5 Inducers Cytochrome P-450 CYP3A5 Inducers (strong) Cytochrome P-450 CYP3A7 Inducers Cytochrome P-450 CYP3A7 Inducers (strong) Cytochrome P-450 Enzyme Inducers Cytotoxins Hydrocarbons, Chlorinated Hydrocarbons, Halogenated Narrow Therapeutic Index Drugs P-glycoprotein inhibitors Thyroxine-binding globulin inducers
Cross-references: BindingDB: 50239991 ChEBI: 6954 CHEMBL1670 ChemSpider: 4066 Drugs Product Database (DPD): 2100 D00420 PharmGKB: PA164746157 PubChem:4211 PubChem:46508319 RxCUI: 7004 Therapeutic Targets Database: DAP000033 Wikipedia: Mitotane
Target Activities (3)
DrugBank Target Actions (12)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P04278 | SHBG | Sex hormone-binding globulin | upregulator | carriers |
| P05543 | P05543 | Thyroxine-binding globulin | upregulator | carriers |
| P08185 | SERPINA6 | Corticosteroid-binding globulin | upregulator | carriers |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | inducer | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | inducer | enzymes |
| P24462 | CYP3A7 | Cytochrome P450 3A7 | inducer | enzymes |
| P06401 | PGR | Progesterone receptor | antagonist | targets |
| P10275 | AR | Androgen receptor | antagonist | targets |
| P03372 | ESR1 | Estrogen receptor | binder | targets |
| P15538 | CYP11B1 | Cytochrome P450 11B1, mitochondrial | inducer | targets |
| P10109 | P10109 | Adrenodoxin, mitochondrial | unknown | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inhibitor | transporters |