Molecule Details
| InChIKey | JUSFANSTBFGBAF-IRXDYDNUSA-N |
|---|---|
| Compound Name | Vistusertib |
| Canonical SMILES | CNC(=O)c1cccc(-c2ccc3c(N4CCOC[C@@H]4C)nc(N4CCOC[C@@H]4C)nc3n2)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.09 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11925 |
|---|---|
| Drug Name | Vistusertib |
| CAS Number | 1009298-59-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Vistusertib is under investigation for the treatment of Advanced Gastric Adenocarcinoma. |
Categories: Acids, Carbocyclic Amides Benzene Derivatives Benzoates Oxazines Protein Kinase Inhibitors mTOR Inhibitors
Cross-references: BindingDB: 50429701 CHEMBL2336325 ChemSpider: 28294977 PubChem:25262792 PubChem:347828256 ZINC: ZINC000059258964
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P42345 | MTOR | Homo sapiens | Human | PF02259 PF02260 PF08771 PF23593 PF11865 PF00454 | 8.6 | IC50 | ChEMBL;BindingDB |
| P42336 | PIK3CA | Homo sapiens | Human | PF00454 PF00792 PF02192 PF00794 PF00613 | 7.5 | Kd | ChEMBL;BindingDB |
| Q8N122 | RPTOR | Homo sapiens | Human | PF02985 PF14538 PF00400 | 6.7 | IC50 | ChEMBL |
| Q9BVC4 | MLST8 | Homo sapiens | Human | PF00400 | 6.7 | IC50 | ChEMBL |
| Q01813 | PFKP | Homo sapiens | Human | PF00365 | 6.0 | Kd | ChEMBL |