Molecule Details
| InChIKey | JTVPZMFULRWINT-UHFFFAOYSA-N |
|---|---|
| Compound Name | Tiapride |
| Canonical SMILES | CCN(CC)CCNC(=O)c1cc(S(C)(=O)=O)ccc1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.78 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13025 |
|---|---|
| Drug Name | Tiapride |
| CAS Number | 51012-32-9 |
| Groups | investigational |
| ATC Codes | N05AL03 |
| Description | Tiapride is a selective D2 and D3 dopamine receptor blocker in the brain. |
Categories: Acids, Carbocyclic Amines Antipsychotic Agents Benzamides and benzamide derivatives Benzene Derivatives Benzoates Central Nervous System Agents Central Nervous System Depressants Dopamine Agents Dopamine Antagonists Dopamine D2 Receptor Antagonists Drugs that are Mainly Renally Excreted Ethylamines Nervous System Neurotoxic agents Neurotransmitter Agents Psycholeptics Psychotropic Drugs Tranquilizing Agents
Cross-references: BindingDB: 82073 ChEBI: 94666 CHEMBL84158 ChemSpider: 5268 D08590 PubChem:5467 PubChem:347829159 RxCUI: 10588 Wikipedia: Tiapride ZINC: ZINC000001542927
Target Activities (4)
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08908 | HTR1A | Serotonin Receptors | antagonist | targets |
| P08913 | ADRA2A | Alpha-2 adrenergic receptors | antagonist | targets |
| P35348 | ADRA1A | Alpha-1 adrenergic receptors | antagonist | targets |
| P14416 | DRD2 | D(2) dopamine receptor | blocker | targets |
| P35462 | DRD3 | D(3) dopamine receptor | blocker | targets |
| Q9Y5Y9 | SCN10A | Sodium channel protein type 10 subunit alpha | inhibitor | targets |