Molecule Details
| InChIKey | JQUVQWMHZSYCRQ-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | CCCCOc1c(OC)cc(C(=O)NCC2(N(C)C)CCOCC2)cc1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.06 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16271 |
|---|---|
| Drug Name | Opiranserin |
| CAS Number | 1441000-45-8 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Opiranserin is under investigation in clinical trial NCT03997838 (Evaluate the Efficacy and Safety of VVZ-149 Injections for the Treatment of Post-operative Pain Following Abdominoplasty). |
Cross-references: BindingDB: 50459963 CHEMBL4228903 ChemSpider: 64835236 Wikipedia: Opiranserin