Molecule Details
| InChIKey | JOFWLTCLBGQGBO-UHFFFAOYSA-N |
|---|---|
| Compound Name | Triazolam |
| Canonical SMILES | Cc1nnc2n1-c1ccc(Cl)cc1C(c1ccccc1Cl)=NC2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 8 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.41 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00897 |
|---|---|
| Drug Name | Triazolam |
| CAS Number | 28911-01-5 |
| Groups | approved investigational |
| ATC Codes | N05CD05 |
| Description | Withdrawn in the United Kingdom due to risk of psychiatric adverse drug reactions. This drug continues to be available in the U.S. Internationally, triazolam is a Schedule IV drug under the Convention on Psychotropic Substances. |
Categories: Adjuvants, Anesthesia Agents Causing Muscle Toxicity Anti-Anxiety Agents Benzazepines Benzodiazepine hypnotics and sedatives Benzodiazepines and benzodiazepine derivatives Central Nervous System Agents Central Nervous System Depressants Cytochrome P-450 CYP2C8 Inhibitors Cytochrome P-450 CYP2C8 Inhibitors (strength unknown) Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 CYP3A5 Substrates Cytochrome P-450 CYP3A7 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs that are Mainly Renally Excreted GABA Agents GABA Modulators Heterocyclic Compounds, Fused-Ring Hypnotics and Sedatives Nervous System Neurotransmitter Agents Psycholeptics Psychotropic Drugs Tranquilizing Agents Triazolobenzodiazepines
Cross-references: BindingDB: 50001765 ChEBI: 9674 CHEMBL646 ChemSpider: 5355 Drugs Product Database (DPD): 2117 D00387 PharmGKB: PA451753 PubChem:5556 PubChem:46509147 RxCUI: 10767 Therapeutic Targets Database: DAP000244 Wikipedia: Triazolam ZINC: ZINC000000002212
Target Activities (8)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P47869 | GABRA2 | Homo sapiens | Human | PF02931 PF02932 | 9.2 | Ki | ChEMBL;BindingDB |
| P18507 | GABRG2 | Homo sapiens | Human | PF02931 PF02932 | 9.0 | Ki | ChEMBL |
| P28472 | GABRB3 | Homo sapiens | Human | PF02931 PF02932 | 9.0 | Ki | ChEMBL |
| P14867 | GABRA1 | Homo sapiens | Human | PF02931 PF02932 | 8.9 | Ki | ChEMBL;BindingDB |
| P34903 | GABRA3 | Homo sapiens | Human | PF02931 PF02932 | 8.8 | Ki | ChEMBL;BindingDB |
| P31644 | GABRA5 | Homo sapiens | Human | PF02931 PF02932 | 8.8 | Ki | ChEMBL;BindingDB |
| Q8N1C3 | GABRG1 | Homo sapiens | Human | PF02931 PF02932 | 7.3 | Ki | BindingDB |
| P25105 | PTAFR | Homo sapiens | Human | PF00001 | 6.2 | Ki | BindingDB |
DrugBank Target Actions (7)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P10632 | CYP2C8 | Cytochrome P450 2C8 | inhibitor | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P20815 | CYP3A5 | Cytochrome P450 3A5 | substrate | enzymes |
| P24462 | CYP3A7 | Cytochrome P450 3A7 | substrate | enzymes |
| P14867 | GABRA1 | GABA(A) Receptor Benzodiazepine Binding Site | ligand | targets |
| P30536 | TSPO | Translocator protein | modulator | targets |
| P14867 | GABRA1 | GABA(A) Receptor | positive allosteric modulator | targets |