Molecule Details
| InChIKey | JOAHPSVPXZTVEP-YXJHDRRASA-N |
|---|---|
| Compound Name | Terguride |
| Canonical SMILES | CCN(CC)C(=O)N[C@H]1C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]2N(C)C1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 19 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.12 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB13399 |
|---|---|
| Drug Name | Terguride |
| CAS Number | 37686-84-3 |
| Groups | experimental |
| ATC Codes | G02CB06 |
| Description | nan |
Categories: Agents that produce hypertension Alkaloids Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Dopamine Agents Ergolines Ergot Alkaloids and Derivatives Genito Urinary System and Sex Hormones Heterocyclic Compounds, Fused-Ring Neurotransmitter Agents Prolactine Inhibitors
Cross-references: BindingDB: 50017519 ChEBI: 32193 CHEMBL73151 ChemSpider: 392004 D01348 Wikipedia: Terguride ZINC: ZINC000003811327
Target Activities (19)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 9.5 | Ki | BindingDB |
| P18089 | ADRA2B | Homo sapiens | Human | PF00001 | 9.3 | Ki | BindingDB |
| P18825 | ADRA2C | Homo sapiens | Human | PF00001 | 9.1 | Ki | BindingDB |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 9.1 | Ki | BindingDB |
| P35462 | DRD3 | Homo sapiens | Human | PF00001 | 9.0 | Ki | BindingDB |
| P08908 | HTR1A | Homo sapiens | Human | PF00001 | 8.5 | Ki | BindingDB |
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 8.4 | Ki | BindingDB |
| P25100 | ADRA1D | Homo sapiens | Human | PF00001 | 8.4 | Ki | BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 8.3 | Ki | BindingDB |
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 8.2 | Ki | BindingDB |
| P41595 | HTR2B | Homo sapiens | Human | PF00001 | 8.2 | Ki | BindingDB |
| P28221 | HTR1D | Homo sapiens | Human | PF00001 | 7.8 | Ki | BindingDB |
| P07550 | ADRB2 | Homo sapiens | Human | PF00001 | 7.7 | Ki | BindingDB |
| P21918 | DRD5 | Homo sapiens | Human | PF00001 | 7.6 | Ki | BindingDB |
| P21728 | DRD1 | Homo sapiens | Human | PF00001 | 7.5 | Ki | BindingDB |
| P35368 | ADRA1B | Homo sapiens | Human | PF00001 | 7.5 | Ki | BindingDB |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 7.3 | Ki | BindingDB |
| P28222 | HTR1B | Homo sapiens | Human | PF00001 | 6.6 | Ki | BindingDB |
| P08588 | ADRB1 | Homo sapiens | Human | PF00001 | 6.2 | Ki | BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |