Molecule Details
| InChIKey | JMPZTWDLOGTBPM-OUQSKUGOSA-N |
|---|---|
| Compound Name | Alrt-1550 |
| Canonical SMILES | CC(/C=C/C=C(\C)c1cc(C(C)(C)C)cc(C(C)(C)C)c1)=C\C(=O)O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.59 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB05785 |
|---|---|
| Drug Name | LGD-1550 |
| CAS Number | 178600-20-9 |
| Groups | experimental |
| ATC Codes | nan |
| Description | LGD-1550 is an orally-active synthetic aromatic retinoic acid agent with potential antineoplastic and chemopreventive activities. |
Categories: Alkenes Biological Factors Carotenoids Cyclohexanes Cyclohexenes Cycloparaffins Hydrocarbons, Acyclic Pigments, Biological Polyenes Receptors, Retinoic Acid, agonists Terpenes
Cross-references: BindingDB: 50052033 CHEMBL89241 ChemSpider: 4450017 PDB: ARL PubChem:347910230
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P19793 | RXRA | Homo sapiens | Human | PF00104 PF11825 PF00105 | 8.3 | Ki | ChEMBL;BindingDB |
| P48443 | RXRG | Homo sapiens | Human | PF00104 PF11825 PF00105 | 8.0 | Ki | ChEMBL;BindingDB |
| P28702 | RXRB | Homo sapiens | Human | PF00104 PF00105 | 8.0 | Ki | ChEMBL;BindingDB |
| P10276 | RARA | Homo sapiens | Human | PF00104 PF00105 | 7.2 | Ki | ChEMBL;BindingDB |
| P10826 | RARB | Homo sapiens | Human | PF00104 PF00105 | 7.0 | Ki | ChEMBL;BindingDB |
| P13631 | RARG | Homo sapiens | Human | PF00104 PF00105 | 6.9 | Ki | ChEMBL;BindingDB |