Molecule Details
| InChIKey | JLYXXMFPNIAWKQ-GNIYUCBRSA-N |
|---|---|
| Canonical SMILES | Cl[C@H]1[C@H](Cl)[C@@H](Cl)[C@@H](Cl)[C@H](Cl)[C@H]1Cl |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.68 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00431 |
|---|---|
| Drug Name | Lindane |
| CAS Number | 58-89-9 |
| Groups | approved withdrawn |
| ATC Codes | P03AB02 |
| Description | An organochlorine insecticide that has been used as a pediculicide and a scabicide. Lindane has been banned in California, United Kingdom, Australia, and many western countries due to concerns about neurotoxicity and adverse effects on the environment. In Canada, Lindane is not recommmended as a fir... |
Categories: Agents that reduce seizure threshold Agrochemicals Antiparasitic Products, Insecticides and Repellents Chlorine Containing Products Compounds used in a research, industrial, or household setting Ectoparasiticides, Incl. Scabicides Ectoparasiticides, Incl. Scabicides, Insecticides and Repellents Hydrocarbons, Chlorinated Hydrocarbons, Halogenated Insecticides Pesticides Toxic Actions
Cross-references: BindingDB: 50410525 ChEBI: 32888 CHEMBL15891 ChemSpider: 10481896 Drugs Product Database (DPD): 6327 C07075 D00360 PharmGKB: PA164754914 PubChem:727 PubChem:46508542 RxCUI: 1388 Therapeutic Targets Database: DAP001036 Wikipedia: Lindane
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q16445 | GABRA6 | Homo sapiens | Human | PF02931 PF02932 | 8.6 | IC50 | ChEMBL |
| P28472 | GABRB3 | Homo sapiens | Human | PF02931 PF02932 | 8.3 | IC50 | ChEMBL |
| P18507 | GABRG2 | Homo sapiens | Human | PF02931 PF02932 | 7.7 | IC50 | ChEMBL |
| P14867 | GABRA1 | Homo sapiens | Human | PF02931 PF02932 | 7.4 | IC50 | ChEMBL |
| P18505 | GABRB1 | Homo sapiens | Human | PF02931 PF02932 | 7.1 | IC50 | ChEMBL |
| P24046 | GABRR1 | Homo sapiens | Human | PF02931 PF02932 | 7.0 | IC50 | ChEMBL |
DrugBank Target Actions (10)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| O75469 | NR1I2 | Nuclear receptor subfamily 1 group I member 2 | activator | targets |
| O75311 | O75311 | Glycine receptor subunit alpha-3 | antagonist | targets |
| P03372 | ESR1 | Estrogen receptor | antagonist | targets |
| P06401 | PGR | Progesterone receptor | antagonist | targets |
| P18505 | GABRB1 | Gamma-aminobutyric acid receptor subunit beta-1 | antagonist | targets |
| P23415 | GLRA1 | Glycine receptor subunit alpha-1 | antagonist | targets |
| P23416 | P23416 | Glycine receptor subunit alpha-2 | antagonist | targets |
| P24046 | GABRR1 | Gamma-aminobutyric acid receptor subunit rho-1 | antagonist | targets |
| P28472 | GABRB3 | Gamma-aminobutyric acid receptor subunit beta-3 | antagonist | targets |
| P48167 | GLRB | Glycine receptor subunit beta | antagonist | targets |