Molecule Details
| InChIKey | JLUUVUUYIXBDCG-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | CNc1nc(-c2nc3ccc(N4CCN(C)CC4)cc3n2Cc2ccccc2)cn2c(C)nnc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.05 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21566 |
|---|---|
| Drug Name | Amredobresib |
| CAS Number | 1610044-98-8 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Amredobresib is a small molecule drug. The usage of the INN stem '-bresib' in the name indicates that Amredobresib is a inhibitor of the bromodomain and extra-terminal motif (BET) family of bromodomain (BRD) protein, antineoplastic. Amredobresib is under investigation in clinical trial NCT02516553 (... |
Cross-references: BindingDB: 209472 CHEMBL3919831 PDB: ZHO