Molecule Details
| InChIKey | JKDGKIBAOAFRPJ-ZBINZKHDSA-N |
|---|---|
| Compound Name | Zimlovisertib |
| Canonical SMILES | CC[C@@H]1[C@H](F)C(=O)N[C@@H]1COc1nccc2cc(C(N)=O)c(OC)cc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.8 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB15143 |
|---|---|
| Drug Name | Zimlovisertib |
| CAS Number | 1817626-54-2 |
| Groups | investigational |
| ATC Codes | nan |
| Description | PF-06650833 is under investigation in clinical trial NCT02609139 (Study to Evaluate Pharmacokinetics of A Modified Release Formulation of PF-06650833 in Healthy Subjects). |
Categories: Amides Heterocyclic Compounds, Fused-Ring
Cross-references: BindingDB: 50239499 CHEMBL4081711 ChemSpider: 58805665 PDB: 8CG ZINC: ZINC000526061587