Molecule Details
| InChIKey | JJZFWROHYSMCMU-UHFFFAOYSA-N |
|---|---|
| Compound Name | Intepirdine |
| Canonical SMILES | O=S(=O)(c1ccccc1)c1cnc2c(N3CCNCC3)cccc2c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.5 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12680 |
|---|---|
| Drug Name | Intepirdine |
| CAS Number | 607742-69-8 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Intepirdine has been used in trials studying the treatment of Alzheimer's Disease. |
Categories: Heterocyclic Compounds, Fused-Ring Sulfur Compounds
Cross-references: BindingDB: 50318633 CHEMBL1083390 ChemSpider: 9431746 PubChem:11256720 PubChem:347828884 Wikipedia: Intepirdine ZINC: ZINC000043199965
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P50406 | HTR6 | Homo sapiens | Human | PF00001 | 8.8 | Ki | ChEMBL;BindingDB |
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 7.6 | Ki | ChEMBL;BindingDB |
| P08908 | HTR1A | Homo sapiens | Human | PF00001 | 7.6 | Ki | ChEMBL;BindingDB |
| P14416 | DRD2 | Homo sapiens | Human | PF00001 | 6.0 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P50406 | HTR6 | 5-hydroxytryptamine receptor 6 | antagonist | targets |