Molecule Details
| InChIKey | JJWLXRKVUJDJKG-VIFPVBQESA-N |
|---|---|
| Compound Name | Bms-863233 |
| Canonical SMILES | O=c1[nH]c([C@@H]2CCCN2)nc2c1oc1ccc(Cl)cc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.12 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12357 |
|---|---|
| Drug Name | BMS-863233 |
| CAS Number | 1169558-38-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | BMS-863233 has been investigated for the treatment of Refractory Hematologic Cancer. |
Cross-references: BindingDB: 50383714 CHEMBL2030402 ChemSpider: 28508270 PDB: 0SX PubChem:57899889 PubChem:347828610 ZINC: ZINC000084668615
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P19784 | CSNK2A2 | Homo sapiens | Human | PF00069 | 7.7 | Kd | ChEMBL |
| Q13627 | DYRK1A | Homo sapiens | Human | PF00069 | 7.4 | Kd | ChEMBL |
| P11309 | PIM1 | Homo sapiens | Human | PF00069 | 7.4 | IC50 | ChEMBL;BindingDB |
| O00311 | CDC7 | Homo sapiens | Human | PF00069 | 6.9 | IC50 | ChEMBL;BindingDB |
| P67870 | CSNK2B | Homo sapiens | Human | PF01214 | 6.7 | IC50 | ChEMBL |
| P68400 | CSNK2A1 | Homo sapiens | Human | PF00069 | 6.7 | IC50 | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| O00311 | CDC7 | Cell division cycle 7-related protein kinase | modulator | targets |