Molecule Details
| InChIKey | JHVHEDNLONERHY-UHFFFAOYSA-N |
|---|---|
| Compound Name | Cns 5161 |
| Canonical SMILES | CSc1cccc(N(C)C(=N)Nc2cc(SC)ccc2Cl)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.71 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB05824 |
|---|---|
| Drug Name | CNS-5161 |
| CAS Number | nan |
| Groups | experimental |
| ATC Codes | nan |
| Description | CNS 5161 is a blocker of the NMDA ion channel and has completed Phase IIa proof of concept clinical trials as a novel compound for the treatment of neuropathic pain. |
Cross-references: BindingDB: 50096974 CHEMBL41306 ChemSpider: 167230 PubChem:192711 PubChem:175427040 ZINC: ZINC000005423063
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| O15399 | GRIN2D | Homo sapiens | Human | PF01094 PF00060 PF10613 | 8.7 | Ki | ChEMBL |
| O60391 | GRIN3B | Homo sapiens | Human | PF00060 PF10613 | 8.7 | Ki | ChEMBL |
| Q05586 | GRIN1 | Homo sapiens | Human | PF01094 PF00060 PF10613 | 8.7 | Ki | ChEMBL |
| Q12879 | GRIN2A | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 8.7 | Ki | ChEMBL |
| Q13224 | GRIN2B | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 8.7 | Ki | ChEMBL |
| Q14957 | GRIN2C | Homo sapiens | Human | PF01094 PF00060 PF10613 PF10565 | 8.7 | Ki | ChEMBL |
| Q8TCU5 | GRIN3A | Homo sapiens | Human | PF01094 PF00060 PF10613 | 8.7 | Ki | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q05586 | GRIN1 | Glutamate receptor ionotropic, NMDA 1 | binder | targets |