Molecule Details
| InChIKey | JHBXNPBKSPYOFT-UHFFFAOYSA-N |
|---|---|
| Compound Name | 9-(4-Hydroxybutyl)-N2-Phenylguanine |
| Canonical SMILES | O=c1[nH]c(Nc2ccccc2)nc2c1ncn2CCCCO |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.05 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB02495 |
|---|---|
| Drug Name | 9-(4-hydroxybutyl)-N2-phenylguanine |
| CAS Number | nan |
| Groups | experimental |
| ATC Codes | nan |
| Description | 9-(4-hydroxybutyl)-N2-phenylguanine is a solid. This compound belongs to the hypoxanthines. These are compounds containing the purine derivative 1H-purin-6(9H)-one. 9-(4-hydroxybutyl)-n2-phenylguanine is known to target thymidine kinase. |
Cross-references: BindingDB: 21866 CHEMBL406254 ChemSpider: 395019 PDB: BPG PubChem:448110 PubChem:46507186