Molecule Details
| InChIKey | JERXUPDBWDWFCF-UHFFFAOYSA-N |
|---|---|
| Compound Name | Elbimilast |
| Canonical SMILES | O=C(Nc1c(Cl)cncc1Cl)C(=O)c1cn(Cc2ccc(F)cc2)c2ncccc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.51 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB20663 |
|---|---|
| Drug Name | Elbimilast |
| CAS Number | 418794-42-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Elbimilast is a small molecule drug. The usage of the INN stem '-milast' in the name indicates that Elbimilast is a Phosphodiesterase-4 (PDE4) inhibitor. Elbimilast is under investigation in clinical trial NCT00977886 (Safety and Pharmacokinetics of ELB353 in Healthy Men). Elbimilast has a monoisoto... |
Cross-references: BindingDB: 50559692 CHEMBL4568146
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P27815 | PDE4A | Homo sapiens | Human | PF18100 PF00233 | 8.5 | IC50 | ChEMBL |
| Q07343 | PDE4B | Homo sapiens | Human | PF18100 PF00233 | 8.5 | IC50 | ChEMBL;BindingDB |
| Q08493 | PDE4C | Homo sapiens | Human | PF18100 PF00233 | 8.5 | IC50 | ChEMBL |
| Q08499 | PDE4D | Homo sapiens | Human | PF18100 PF00233 | 8.5 | IC50 | ChEMBL |