Molecule Details
| InChIKey | IZEKFCXSFNUWAM-UHFFFAOYSA-N |
|---|---|
| Compound Name | Dipyridamole |
| Canonical SMILES | OCCN(CCO)c1nc(N2CCCCC2)c2nc(N(CCO)CCO)nc(N3CCCCC3)c2n1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 19 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.58 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00975 |
|---|---|
| Drug Name | Dipyridamole |
| CAS Number | 58-32-2 |
| Groups | approved investigational |
| ATC Codes | B01AC07 |
| Description | A phosphodiesterase inhibitor that blocks uptake and metabolism of adenosine by erythrocytes and vascular endothelial cells. Dipyridamole also potentiates the antiaggregating action of prostacyclin. (From AMA Drug Evaluations Annual, 1994, p752) |
Categories: Anticoagulants Antiplatelet agents BSEP/ABCB11 Substrates Blood and Blood Forming Organs Cardiovascular Agents Decreased Platelet Aggregation Enzyme Inhibitors Hematologic Agents Hypotensive Agents Miscellaneous Vasodilatating Agents OATP1B1/SLCO1B1 Inhibitors OATP1B3 inhibitors Organic Anion Transporting Polypeptide 2B1 Inhibitors P-glycoprotein inhibitors P-glycoprotein substrates Phosphodiesterase 5 Inhibitors Phosphodiesterase Inhibitors Platelet Aggregation Inhibitors Excl. Heparin Pyrimidines Vasodilating Agents
Cross-references: BindingDB: 23620 ChEBI: 4653 CHEMBL932 ChemSpider: 2997 Drugs Product Database (DPD): 7219 D00302 PDB: H9F PharmGKB: PA449367 PubChem:3108 PubChem:46506292 RxCUI: 3521 Therapeutic Targets Database: DNC001625 Wikipedia: Dipyridamole ZINC: ZINC000000643046
Target Activities (19)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q99808 | SLC29A1 | Homo sapiens | Human | PF01733 | 8.1 | Ki | ChEMBL;BindingDB |
| O43924 | PDE6D | Homo sapiens | Human | PF05351 | 6.9 | Ki | ChEMBL |
| P16499 | PDE6A | Homo sapiens | Human | PF01590 PF00233 | 6.9 | Ki | ChEMBL |
| P18545 | PDE6G | Homo sapiens | Human | PF04868 | 6.9 | Ki | ChEMBL |
| P35913 | PDE6B | Homo sapiens | Human | PF01590 PF00233 | 6.9 | Ki | ChEMBL |
| P51160 | PDE6C | Homo sapiens | Human | PF01590 PF00233 | 6.9 | Ki | ChEMBL;BindingDB |
| Q13956 | PDE6H | Homo sapiens | Human | PF04868 | 6.9 | Ki | ChEMBL |
| Q9HCR9 | PDE11A | Homo sapiens | Human | PF01590 PF00233 | 6.4 | Ki | ChEMBL;BindingDB |
| O60658 | PDE8A | Homo sapiens | Human | PF00989 PF08629 PF23198 PF00233 | 6.3 | IC50 | BindingDB |
| P27815 | PDE4A | Homo sapiens | Human | PF18100 PF00233 | 6.3 | IC50 | ChEMBL |
| Q07343 | PDE4B | Homo sapiens | Human | PF18100 PF00233 | 6.3 | IC50 | ChEMBL;BindingDB |
| Q08493 | PDE4C | Homo sapiens | Human | PF18100 PF00233 | 6.3 | IC50 | ChEMBL |
| Q08499 | PDE4D | Homo sapiens | Human | PF18100 PF00233 | 6.3 | IC50 | ChEMBL |
| O76074 | PDE5A | Homo sapiens | Human | PF01590 PF00233 | 6.3 | IC50 | ChEMBL;BindingDB |
| Q13946 | PDE7A | Homo sapiens | Human | PF00233 | 6.2 | Ki | ChEMBL;BindingDB |
| Q9NP56 | PDE7B | Homo sapiens | Human | PF00233 | 6.2 | IC50 | ChEMBL |
| Q86TP1 | PRUNE1 | Homo sapiens | Human | PF01368 PF02833 | 6.1 | IC50 | ChEMBL;BindingDB |
| Q9Y233 | PDE10A | Homo sapiens | Human | PF01590 PF00233 | 6.0 | Ki | ChEMBL;BindingDB |
| P0DTD1 | rep | Severe acute respiratory syndrome coronavirus 2 | Pathogen | PF13087 PF16251 PF11501 PF12379 PF12124 PF11633 PF06471 PF06460 PF09401 PF20631 PF20633 PF20632 PF19215 PF19216 PF19219 PF19211 PF19218 PF16348 PF19217 PF19213 PF08716 PF08717 PF08710 PF08715 PF06478 PF01661 PF05409 PF00680 | 6.8 | IC50 | ChEMBL |
DrugBank Target Actions (14)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02763 | P02763 | Alpha-1-acid glycoprotein 1 | binder | targets |
| O76074 | PDE5A | cGMP-specific 3',5'-cyclic phosphodiesterase | inhibitor | targets |
| P00813 | ADA | Adenosine deaminase | inhibitor | targets |
| P27815 | PDE4A | 3',5'-cyclic-AMP phosphodiesterase 4A | inhibitor | targets |
| P53805 | P53805 | Calcipressin-1 | inhibitor | targets |
| Q9Y233 | PDE10A | cAMP and cAMP-inhibited cGMP 3',5'-cyclic phosphodiesterase 10A | inhibitor | targets |
| O15439 | O15439 | ATP-binding cassette sub-family C member 4 | inhibitor | transporters |
| O15440 | O15440 | ATP-binding cassette sub-family C member 5 | inhibitor | transporters |
| O94956 | SLCO2B1 | Solute carrier organic anion transporter family member 2B1 | inhibitor | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | inhibitor | transporters |
| Q9NPD5 | SLCO1B3 | Solute carrier organic anion transporter family member 1B3 | inhibitor | transporters |
| Q9Y6L6 | SLCO1B1 | Solute carrier organic anion transporter family member 1B1 | inhibitor | transporters |
| O95342 | ABCB11 | Bile salt export pump | substrate | transporters |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |