Molecule Details
| InChIKey | IZBNNCFOBMGTQX-UHFFFAOYSA-N |
|---|---|
| Compound Name | Etoperidone |
| Canonical SMILES | CCc1nn(CCCN2CCN(c3cccc(Cl)c3)CC2)c(=O)n1CC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.84 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB09194 |
|---|---|
| Drug Name | Etoperidone |
| CAS Number | 52942-31-1 |
| Groups | approved withdrawn |
| ATC Codes | N06AB09 |
| Description | Etoperidone is an atypical antidepressant introduced in Europe in 1977. It is a phenylpiperazine-substituted triazole derivative with a composition that classifies it as an analog of tradozone and presents a similar pharmacological profile.[T45] Etoperidone was developed by Angelini Francesco ACRAF.... |
Categories: Antidepressive Agents Central Nervous System Depressants Combined Inhibitors of Serotonin/Norepinephrine Reuptake Drugs that are Mainly Renally Excreted Nervous System Piperazines Psychoanaleptics Pyridines Pyridones Serotonergic Drugs Shown to Increase Risk of Serotonin Syndrome Serotonin 5-HT2 Receptor Antagonists Serotonin 5-HT2A Receptor Antagonists Serotonin Agents Serotonin Modulators Serotonin Receptor Antagonists
Cross-references: BindingDB: 82438 ChEBI: 135589 CHEMBL1743259 ChemSpider: 37083 PubChem:40589 PubChem:310265102 Wikipedia: Etoperidone ZINC: ZINC000003830815
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 7.4 | Ki | BindingDB |
| P35348 | ADRA1A | Homo sapiens | Human | PF00001 | 7.4 | Ki | BindingDB |
| P08908 | HTR1A | Homo sapiens | Human | PF00001 | 7.1 | Ki | BindingDB |
| P08913 | ADRA2A | Homo sapiens | Human | PF00001 | 6.2 | Ki | BindingDB |
| P31645 | SLC6A4 | Homo sapiens | Human | PF03491 PF00209 | 6.0 | Ki | BindingDB |
DrugBank Target Actions (9)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P28335 | HTR2C | 5-hydroxytryptamine receptor 2C | agonist | targets |
| P08913 | ADRA2A | Alpha-2 adrenergic receptors | antagonist | targets |
| P11229 | CHRM1 | Muscarinic acetylcholine receptor | antagonist | targets |
| P14416 | DRD2 | D(2) dopamine receptor | antagonist | targets |
| P28223 | HTR2A | 5-hydroxytryptamine receptor 2A | antagonist | targets |
| P35348 | ADRA1A | Alpha-1 adrenergic receptors | antagonist | targets |
| P23975 | SLC6A2 | Sodium-dependent noradrenaline transporter | inhibitor | transporters |
| P31645 | SLC6A4 | Sodium-dependent serotonin transporter | inhibitor | transporters |
| Q01959 | SLC6A3 | Sodium-dependent dopamine transporter | inhibitor | transporters |