Molecule Details
| InChIKey | IXZOHGPZAQLIBH-NRFANRHFSA-N |
|---|---|
| Compound Name | Iberdomide |
| Canonical SMILES | O=C1CC[C@H](N2Cc3c(OCc4ccc(CN5CCOCC5)cc4)cccc3C2=O)C(=O)N1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 8 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.39 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12101 |
|---|---|
| Drug Name | Iberdomide |
| CAS Number | 1323403-33-3 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Iberdomide (CC-220) has been used in trials studying the treatment of Systemic Lupus Erythematosus. |
Categories: Acids, Carbocyclic Heterocyclic Compounds, Fused-Ring Imides Isoindoles Oxazines Phthalic Acids Piperidines
Cross-references: BindingDB: 65497 CHEMBL3989927 ChemSpider: 52085251 PDB: 8W7 PubChem:67335295 PubChem:347828405 ZINC: ZINC000118417658
Target Activities (8)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P01584 | IL1B | Homo sapiens | Human | PF00340 PF02394 | 9.3 | IC50 | ChEMBL;BindingDB |
| P01375 | TNF | Homo sapiens | Human | PF00229 | 9.2 | IC50 | ChEMBL;BindingDB |
| Q14676 | MDC1 | Homo sapiens | Human | PF16589 PF00498 PF16770 | 8.7 | IC50 | BindingDB |
| P04141 | CSF2 | Homo sapiens | Human | PF01109 | 8.7 | IC50 | BindingDB |
| P05231 | IL6 | Homo sapiens | Human | PF00489 | 8.4 | IC50 | BindingDB |
| Q96SW2 | CRBN | Homo sapiens | Human | PF02190 PF03226 | 7.8 | IC50 | ChEMBL |
| P10147 | CCL3 | Homo sapiens | Human | PF00048 | 7.5 | IC50 | BindingDB |
| Q16531 | DDB1 | Homo sapiens | Human | PF10433 PF23726 PF03178 | 7.5 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| Q96SW2 | CRBN | Protein cereblon | inhibitor | targets |