Molecule Details
| InChIKey | IXQHNBONEVULTL-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | O=C(Nc1c(Cl)c[n+]([O-])cc1Cl)c1ccc(OC(F)F)c2oc3ccncc3c12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.52 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11838 |
|---|---|
| Drug Name | Revamilast |
| CAS Number | 893555-90-3 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Revamilast has been used in trials studying the treatment of Asthma and Rheumatoid Arthritis. |
Cross-references: ChemSpider: 28290127 PubChem:11546664 PubChem:347828183
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q08499 | PDE4D | Homo sapiens | Human | PF18100 PF00233 | 8.5 | IC50 | ChEMBL |
| P27815 | PDE4A | Homo sapiens | Human | PF18100 PF00233 | 8.5 | IC50 | ChEMBL |
| Q07343 | PDE4B | Homo sapiens | Human | PF18100 PF00233 | 8.5 | IC50 | ChEMBL;BindingDB |
| Q08493 | PDE4C | Homo sapiens | Human | PF18100 PF00233 | 8.5 | IC50 | ChEMBL |