Molecule Details
| InChIKey | IVZKZONQVYTCKC-UHFFFAOYSA-N |
|---|---|
| Compound Name | N-(5-(Aminosulfonyl)-4-methyl-1,3-thiazol-2-yl)-N-methyl-2-(4-(2-pyridinyl)phenyl)acetamide |
| Canonical SMILES | Cc1nc(N(C)C(=O)Cc2ccc(-c3ccccn3)cc2)sc1S(N)(=O)=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.85 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11844 |
|---|---|
| Drug Name | Pritelivir |
| CAS Number | 348086-71-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Pritelivir has been used in trials studying the prevention of HSV-2 and Genital Herpes. |
Categories: Amides Anti-Infective Agents Antiviral Agents Enzyme Inhibitors Sulfones Sulfur Compounds
Cross-references: BindingDB: 50237366 CHEMBL4069597 ChemSpider: 430613 PDB: A1BXB PubChem:491941 PubChem:347828188 Wikipedia: Pritelivir ZINC: ZINC000003955689
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P00918 | CA2 | Homo sapiens | Human | PF00194 | 7.9 | Ki | ChEMBL;BindingDB |
| O43570 | CA12 | Homo sapiens | Human | PF00194 | 7.2 | Ki | ChEMBL;BindingDB |
| Q16790 | CA9 | Homo sapiens | Human | PF00194 | 6.7 | Ki | ChEMBL;BindingDB |
| P00915 | CA1 | Homo sapiens | Human | PF00194 | 6.5 | Ki | ChEMBL;BindingDB |
| Q9Y2D0 | CA5B | Homo sapiens | Human | PF00194 | 6.5 | Ki | ChEMBL;BindingDB |
| P35218 | CA5A | Homo sapiens | Human | PF00194 | 6.3 | Ki | ChEMBL;BindingDB |