Molecule Details
| InChIKey | IRLWJILLXJGJTD-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | COc1ccc(OC(=O)N(CC(=O)O)Cc2ccc(OCCc3nc(-c4ccccc4)oc3C)cc2)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.69 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06510 |
|---|---|
| Drug Name | Muraglitazar |
| CAS Number | 331741-94-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Muraglitazar (Bristol-Myers Squibb/Merck) is a new agent under investigation for the treatment of patients with type 2 diabetes. It belongs to a novel class of drugs that target the peroxisome proliferator-activated receptors, both alpha and gamma subtypes. In addition to improvements in blood gluco... |
Categories: Amino Acids Amino Acids, Peptides, and Proteins Cytochrome P-450 CYP1A2 Substrates Cytochrome P-450 CYP2C8 Substrates Cytochrome P-450 Substrates PPAR alpha, agonists PPAR gamma, agonists UGT1A1 Substrates UGT1A3 substrates
Cross-references: BindingDB: 50150998 CHEMBL186179 ChemSpider: 178524 Wikipedia: Muraglitazar ZINC: ZINC000049650290
Target Activities (2)
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P05177 | CYP1A2 | Cytochrome P450 1A2 | substrate | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | substrate | enzymes |
| P22309 | UGT1A1 | UDP-glucuronosyltransferase 1A1 | substrate | enzymes |
| P35503 | P35503 | UDP-glucuronosyltransferase 1A3 | substrate | enzymes |
| P37231 | PPARG | Peroxisome proliferator-activated receptor gamma | modulator | targets |
| Q07869 | PPARA | Peroxisome proliferator-activated receptor alpha | modulator | targets |