Molecule Details
| InChIKey | IRIRASPSMMWZOM-CJRSTVEYSA-N |
|---|---|
| Canonical SMILES | OC[C@H]1[C@@H](O)[C@H](O)[C@@H](O)CN1CCCCCOCc1ccc(-c2ccccc2)c(F)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.91 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21603 |
|---|---|
| Drug Name | Nizubaglustat |
| CAS Number | 1633666-49-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Nizubaglustat is a small molecule drug. The usage of the INN stem '-glustat' in the name indicates that Nizubaglustat is a ceramide glucosyltransferase inhibitor. Nizubaglustat is under investigation in clinical trial NCT07054515 (A Study to Evaluate the Safety and Efficacy of Oral Nizubaglustat (AZ... |
Cross-references: BindingDB: 50028257 CHEMBL3354637 ZINC: ZINC000299830626