Molecule Details
| InChIKey | IRAXRQFCCSHQDX-WBVHZDCISA-N |
|---|---|
| Canonical SMILES | CCCCOC(=O)N[C@@H](CNC(=O)C[C@H]1CC(c2ccc(C(=N)N)cc2)=NO1)C(=O)OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.55 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21089 |
|---|---|
| Drug Name | Roxifiban |
| CAS Number | 170902-47-3 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Roxifiban is a small molecule drug. The usage of the INN stem '-fiban' in the name indicates that Roxifiban is a fibrinogen receptor antagonist (glycoprotein IIb/IIIa receptor antagonist). Roxifiban has a monoisotopic molecular weight of 447.21 Da. |
Categories: Platelet Glycoprotein GPIIb-IIIa Complex, antagonists & inhibitors
Cross-references: BindingDB: 50075579 CHEMBL18301
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P05106 | ITGB3 | Integrin beta-3 | inhibitor | targets |