Molecule Details
| InChIKey | IQFZADSTVFSHDX-UHFFFAOYSA-N |
|---|---|
| Canonical SMILES | O=c1[nH]ncc(N2CCc3c(ncnc3Oc3ccc(F)cc3C(F)(F)F)C2)c1Cl |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.92 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21510 |
|---|---|
| Drug Name | Evifacotrep |
| CAS Number | 2413739-88-3 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Evifacotrep is a small molecule drug. The usage of the INN stem '-cotrep' in the name indicates that Evifacotrep is a transient receptor potential canonical channel 5 (TRPC5) antagonist. Evifacotrep has a monoisotopic molecular weight of 441.06 Da. |
Cross-references: BindingDB: 50647393 CHEMBL4752870