Molecule Details
| InChIKey | IQFYYKKMVGJFEH-XLPZGREQSA-N |
|---|---|
| Canonical SMILES | Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.79 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB04485 |
|---|---|
| Drug Name | Thymidine |
| CAS Number | 50-89-5 |
| Groups | approved investigational |
| ATC Codes | nan |
| Description | Thymidine is a naturally occurring deoxyribonucleoside that is a crucial component of the DNA salvage pathway and a building block for DNA synthesis.[A274683] While it lacks significant anti-tumor activity on its own,[A274688] it has been extensively investigated for nearly a decade as a biochemical... |
Categories: BCRP/ABCG2 Substrates Deoxyribonucleosides Nucleic Acids, Nucleotides, and Nucleosides Nucleosides Pyrimidine Nucleosides Pyrimidines
Cross-references: BindingDB: 1 ChEBI: 17748 CHEMBL52609 ChemSpider: 5585 C00214 PDB: THM PubChem:5789 PubChem:46507598 RxCUI: 1372538 Wikipedia: Thymidine ZINC: ZINC000000025672
Target Activities (2)
DrugBank Target Actions (5)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P19971 | TYMP | Thymidine phosphorylase | substrate | enzymes |
| O00142 | TK2 | Thymidine kinase 2, mitochondrial | substrate | targets |
| P04183 | TK1 | Thymidine kinase, cytosolic | substrate | targets |
| Q9HAS3 | Q9HAS3 | Solute carrier family 28 member 3 | substrate | transporters |
| Q9UNQ0 | ABCG2 | Broad substrate specificity ATP-binding cassette transporter ABCG2 | substrate | transporters |