Molecule Details
| InChIKey | IMYZQPCYWPFTAG-NGZCFLSTSA-N |
|---|---|
| Compound Name | Dexmecamylamine |
| Canonical SMILES | CN[C@@]1(C)[C@@H]2CC[C@@H](C2)C1(C)C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 8 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.36 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11807 |
|---|---|
| Drug Name | Dexmecamylamine |
| CAS Number | 107538-05-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Dexmecamylamine has been used in trials studying the basic science and treatment of Patients, Depression, Drug Abuse, Pharmacokinetics, and Renal Impairment, among others. |
Categories: Autonomic Ganglionic Blocker Decreased Autonomic Ganglionic Activity
Cross-references: BindingDB: 50045047 CHEMBL2103881 ChemSpider: 28528374 PubChem:12358972 PubChem:347828154 ZINC: ZINC000043763856
Target Activities (8)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P30926 | CHRNB4 | Homo sapiens | Human | PF02931 PF02932 | 6.7 | IC50 | ChEMBL |
| P32297 | CHRNA3 | Homo sapiens | Human | PF02931 PF02932 | 6.7 | IC50 | ChEMBL |
| P17787 | CHRNB2 | Homo sapiens | Human | PF02931 PF02932 | 6.3 | IC50 | ChEMBL |
| P43681 | CHRNA4 | Homo sapiens | Human | PF02931 PF02932 | 6.3 | IC50 | ChEMBL |
| P02708 | CHRNA1 | Homo sapiens | Human | PF02931 PF02932 | 6.2 | IC50 | ChEMBL |
| P07510 | CHRNG | Homo sapiens | Human | PF02931 PF02932 | 6.2 | IC50 | ChEMBL |
| P11230 | CHRNB1 | Homo sapiens | Human | PF02931 PF02932 | 6.2 | IC50 | ChEMBL |
| Q07001 | CHRND | Homo sapiens | Human | PF02931 PF02932 | 6.2 | IC50 | ChEMBL |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P17787 | CHRNB2 | Neuronal acetylcholine receptor subunit beta-2 | antagonist | targets |