Molecule Details
| InChIKey | IMOZEMNVLZVGJZ-QGZVFWFLSA-N |
|---|---|
| Compound Name | Apremilast |
| Canonical SMILES | CCOc1cc([C@@H](CS(C)(=O)=O)N2C(=O)c3cccc(NC(C)=O)c3C2=O)ccc1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.18 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB05676 |
|---|---|
| Drug Name | Apremilast |
| CAS Number | 608141-41-9 |
| Groups | approved investigational |
| ATC Codes | L04AA32 |
| Description | Apremilast, also known as Otezla, is a phosphodiesterase 4 (PDE4) inhibitor used to treat various types of symptoms resulting from certain inflammatory autoimmune diseases. It belongs to the same drug class as [Roflumilast] and [Crisaborole].[A181244,L7495] Initially approved in 2014, it is marketed... |
Categories: Agents reducing cytokine levels Anti-Inflammatory Agents Antineoplastic and Immunomodulating Agents Cytochrome P-450 CYP1A2 Substrates Cytochrome P-450 CYP2A6 Substrates Cytochrome P-450 CYP3A Substrates Cytochrome P-450 CYP3A4 Substrates Cytochrome P-450 Substrates Disease-modifying Antirheumatic Agents Drugs that are Mainly Renally Excreted Enzyme Inhibitors Heterocyclic Compounds, Fused-Ring Immunosuppressive Agents Immunotherapy Isoindoles P-glycoprotein substrates Phosphodiesterase 4 Inhibitors Phosphodiesterase Inhibitors Phthalimides Selective Immunosuppressants
Cross-references: BindingDB: 50248919 ChEBI: 78540 CHEMBL514800 ChemSpider: 9736448 Drugs Product Database (DPD): 22541 D08860 PDB: A9L PubChem:11561674 PubChem:310264858 RxCUI: 1492727 Wikipedia: Apremilast ZINC: ZINC000030691736
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q07343 | PDE4B | Homo sapiens | Human | PF18100 PF00233 | 7.3 | IC50 | ChEMBL;BindingDB |
| P27815 | PDE4A | Homo sapiens | Human | PF18100 PF00233 | 7.1 | IC50 | ChEMBL |
| Q08493 | PDE4C | Homo sapiens | Human | PF18100 PF00233 | 7.1 | IC50 | ChEMBL |
| Q08499 | PDE4D | Homo sapiens | Human | PF18100 PF00233 | 7.1 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (7)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P05177 | CYP1A2 | Cytochrome P450 1A2 | substrate | enzymes |
| P08684 | CYP3A4 | Cytochrome P450 3A4 | substrate | enzymes |
| P11509 | CYP2A6 | Cytochrome P450 2A6 | substrate | enzymes |
| P11802 | CDK4 | Cyclin-dependent kinase 4 | inhibitor | targets |
| Q00534 | CDK6 | Cyclin-dependent kinase 6 | inhibitor | targets |
| Q86V67 | PDE4 | Phosphodiesterase isozyme 4 | inhibitor | targets |
| P08183 | ABCB1 | ATP-dependent translocase ABCB1 | substrate | transporters |