Molecule Details
| InChIKey | ILAYIAGXTHKHNT-UHFFFAOYSA-N |
|---|---|
| Compound Name | Dapivirine |
| Canonical SMILES | Cc1cc(C)c(Nc2ccnc(Nc3ccc(C#N)cc3)n2)c(C)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.14 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB08639 |
|---|---|
| Drug Name | Dapivirine |
| CAS Number | 244767-67-7 |
| Groups | investigational |
| ATC Codes | G01AX17 |
| Description | Dapivirine has been investigated for the prevention of HIV-1 Infections and Topical Penile Exposures. |
Categories: Anti-HIV Agents Anti-Infective Agents Anti-Retroviral Agents Antiviral Agents Genito Urinary System and Sex Hormones Gynecological Antiinfectives and Antiseptics HIV Reverse Transcriptase
Cross-references: CHEMBL70663 ChemSpider: 185837 PDB: TPB PubChem:214347 PubChem:99445110 Wikipedia: Dapivirine ZINC: ZINC000000007761
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P03366 | gag-pol | Gag-Pol polyprotein | inhibitor | targets |