Molecule Details
| InChIKey | IDKAKZRYYDCJDU-HBMMIIHUSA-N |
|---|---|
| Canonical SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)N[C@H]2CC[C@H](O)CC2)[C@H](c2cccc(Cl)c2F)[C@]12C(=O)Nc1cc(Cl)ccc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 8.98 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12541 |
|---|---|
| Drug Name | SAR-405838 |
| CAS Number | 1303607-60-4 |
| Groups | investigational |
| ATC Codes | nan |
| Description | SAR405838 has been used in trials studying the treatment of Neoplasm Malignant. |
Categories: Heterocyclic Compounds, Fused-Ring P-glycoprotein substrates
Cross-references: BindingDB: 50433561 CHEMBL2381408 ChemSpider: 30811498 PDB: 7HC PubChem:53476877 PubChem:347828767 ZINC: ZINC000145424989