Molecule Details
| InChIKey | IBHOLSBDZMIPPT-UHFFFAOYSA-N |
|---|---|
| Compound Name | Tasurgratinib |
| Canonical SMILES | CNC(=O)n1ccc2cc(Oc3ccnc(NC(=O)c4ccc(C5CCN(CCO)CC5)cc4)c3)c(OCCOC)cc21 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 5 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.86 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21222 |
|---|---|
| Drug Name | Tasurgratinib |
| CAS Number | 1622204-21-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Tasurgratinib is a small molecule drug. The usage of the INN stem '-gratinib' in the name indicates that Tasurgratinib is a fibroblast growth factor receptor (FGFR) inhibitor. Tasurgratinib is under investigation in clinical trial NCT04962867 (NCCH2006/MK010 Trial (FORTUNE Trial)). Tasurgratinib has... |
Cross-references: BindingDB: 142256 CHEMBL3686884 PDB: A1LY1 ZINC: ZINC000169711512
Target Activities (5)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P09038 | FGF2 | Homo sapiens | Human | PF00167 | 8.3 | IC50 | ChEMBL;BindingDB |
| P21802 | FGFR2 | Homo sapiens | Human | PF07679 PF13927 PF07714 | 8.3 | IC50 | ChEMBL;BindingDB |
| P22607 | FGFR3 | Homo sapiens | Human | PF21165 PF07679 PF13927 PF07714 | 8.2 | IC50 | ChEMBL;BindingDB |
| P11362 | FGFR1 | Homo sapiens | Human | PF07679 PF00047 PF07714 | 8.2 | IC50 | ChEMBL;BindingDB |
| P22455 | FGFR4 | Homo sapiens | Human | PF07679 PF13927 PF07714 | 6.2 | IC50 | ChEMBL;BindingDB |