Molecule Details
| InChIKey | IBGLGMOPHJQDJB-IHRRRGAJSA-N |
|---|---|
| Canonical SMILES | O[C@H]1CC[C@H](Nc2ncc3nc(Nc4c(F)cc(F)cc4F)n([C@H]4CCOC4)c3n2)CC1 |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 8 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.7 |
| Source | ChEMBL;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11798 |
|---|---|
| Drug Name | Tanzisertib |
| CAS Number | 899805-25-5 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Tanzisertib has been used in trials studying the treatment of Fibrosis, Discoid Lupus, Pulmonary Fibrosis, Interstitial Lung Disease, and Lung Diseases, Interstitial, among others. |
Categories: Alcohols Carbon Radioisotopes Cyclohexanes Cycloparaffins Fatty Alcohols Heterocyclic Compounds, Fused-Ring Hexanols JNK Mitogen-Activated Protein Kinases, antagonists & inhibitors Lipids
Cross-references: BindingDB: 50364378 CHEMBL1950289 ChemSpider: 28492361 PDB: KBI PubChem:11597537 PubChem:347828147 ZINC: ZINC000102930548
Target Activities (8)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P45984 | MAPK9 | Homo sapiens | Human | PF00069 | 8.2 | IC50 | ChEMBL |
| P45983 | MAPK8 | Homo sapiens | Human | PF00069 | 7.0 | IC50 | ChEMBL |
| O14976 | GAK | Homo sapiens | Human | PF00069 PF10409 | 6.8 | Kd | ChEMBL |
| P53779 | MAPK10 | Homo sapiens | Human | PF00069 | 6.7 | IC50 | ChEMBL |
| P00533 | EGFR | Homo sapiens | Human | PF00757 PF14843 PF07714 PF01030 PF21314 | 6.4 | IC50 | ChEMBL |
| P27361 | MAPK3 | Homo sapiens | Human | PF00069 | 6.3 | IC50 | ChEMBL |
| Q16539 | MAPK14 | Homo sapiens | Human | PF00069 | 6.1 | Kd | ChEMBL |
| P49137 | MAPKAPK2 | Homo sapiens | Human | PF00069 | 6.0 | Kd | ChEMBL |