Molecule Details
| InChIKey | IBAQFPQHRJAVAV-ULAWRXDQSA-N |
|---|---|
| Compound Name | Miglitol |
| Canonical SMILES | OCCN1C[C@H](O)[C@@H](O)[C@H](O)[C@H]1CO |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.18 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00491 |
|---|---|
| Drug Name | Miglitol |
| CAS Number | 72432-03-2 |
| Groups | approved |
| ATC Codes | A10BF02 |
| Description | Miglitol inhibits the breakdown complex carbohydrates into glucose. It is primarily used in diabetes mellitus type 2 for establishing greater glycemic control by preventing the digestion of carbohydrates (such as disaccharides, oligosaccharides, and polysaccharides) into monosaccharides which can be... |
Categories: Alimentary Tract and Metabolism Alkaloids Blood Glucose Lowering Agents Carbohydrates Drugs Used in Diabetes Enzyme Inhibitors Glycoside Hydrolase Inhibitors Hypoglycemia-Associated Agents Imines Imino Pyranoses Imino Sugars Oral Hypoglycemics Piperidines
Cross-references: BindingDB: 50242271 ChEBI: 6935 CHEMBL1561 ChemSpider: 390074 C07708 D00625 PDB: MIG PharmGKB: PA164776726 PubChem:441314 PubChem:46504492 RxCUI: 30009 Therapeutic Targets Database: DAP000712 Wikipedia: Miglitol ZINC: ZINC000004097426
Target Activities (3)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P14410 | SI | Homo sapiens | Human | PF13802 PF01055 PF21365 PF00088 | 6.3 | IC50 | ChEMBL;BindingDB |
| P10253 | GAA | Homo sapiens | Human | PF13802 PF01055 PF21365 PF00088 | 6.2 | IC50 | ChEMBL;BindingDB |
| O43451 | MGAM | Homo sapiens | Human | PF13802 PF01055 PF21365 PF00088 | 6.0 | Ki | ChEMBL;BindingDB |
DrugBank Target Actions (6)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P04746 | AMY2A | Pancreatic alpha-amylase | inhibitor | enzymes |
| O43451 | MGAM | Maltase-glucoamylase | antagonist | targets |
| P10253 | GAA | Lysosomal alpha-glucosidase | antagonist | targets |
| Q14697 | GANAB | Neutral alpha-glucosidase AB | antagonist | targets |
| Q8TET4 | Q8TET4 | Neutral alpha-glucosidase C | antagonist | targets |
| O43451 | MGAM | Maltase-glucoamylase | inhibitor | targets |