Molecule Details
| InChIKey | HYYBABOKPJLUIN-UHFFFAOYSA-N |
|---|---|
| Compound Name | Mefenamic Acid |
| Canonical SMILES | Cc1cccc(Nc2ccccc2C(=O)O)c1C |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.98 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB00784 |
|---|---|
| Drug Name | Mefenamic acid |
| CAS Number | 61-68-7 |
| Groups | approved |
| ATC Codes | M01AG01 |
| Description | A non-steroidal anti-inflammatory agent with analgesic, anti-inflammatory, and antipyretic properties. It is an inhibitor of cyclooxygenase. |
Categories: Acids, Carbocyclic Agents causing hyperkalemia Agents that produce hypertension Amines Aminobenzoates Analgesics Analgesics, Non-Narcotic Aniline Compounds Anti-Inflammatory Agents Anti-Inflammatory Agents, Non-Steroidal Anti-Inflammatory Agents, Non-Steroidal (Non-Selective) Antiinflammatory and Antirheumatic Products Antiinflammatory and Antirheumatic Products, Non-Steroids Antirheumatic Agents Benzene Derivatives Benzoates Central Nervous System Agents Cyclooxygenase Inhibitors Cytochrome P-450 CYP1A2 Inhibitors Cytochrome P-450 CYP1A2 Inhibitors (weak) Cytochrome P-450 CYP1A2 Substrates Cytochrome P-450 CYP2C8 Inhibitors Cytochrome P-450 CYP2C8 Inhibitors (strength unknown) Cytochrome P-450 CYP2C9 Inhibitors Cytochrome P-450 CYP2C9 Inhibitors (weak) Cytochrome P-450 CYP2C9 Substrates Cytochrome P-450 Enzyme Inhibitors Cytochrome P-450 Substrates Drugs causing inadvertant photosensitivity Enzyme Inhibitors Fenamates Musculo-Skeletal System Nephrotoxic agents Other Nonsteroidal Anti-inflammatory Agents Peripheral Nervous System Agents Photosensitizing Agents Sensory System Agents UGT1A9 Inhibitors UGT2B7 Inhibitors ortho-Aminobenzoates
Cross-references: BindingDB: 50134036 ChEBI: 6717 CHEMBL686 ChemSpider: 3904 Drugs Product Database (DPD): 10002 Guide to Pharmacology: 2593 IUPHAR: 2593 C02168 D00151 PDB: ID8 PharmGKB: PA450347 PubChem:4044 PubChem:46505405 RxCUI: 6693 Therapeutic Targets Database: DAP000779 Wikipedia: Mefenamic_acid ZINC: ZINC000000020241
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q6XQN6 | NAPRT | Homo sapiens | Human | PF17956 PF17767 | 10.3 | Ki | ChEMBL |
| P23219 | PTGS1 | Homo sapiens | Human | PF03098 | 6.9 | IC50 | ChEMBL |
| P52895 | AKR1C2 | Homo sapiens | Human | PF00248 | 6.7 | Ki | ChEMBL;BindingDB |
| P35354 | PTGS2 | Homo sapiens | Human | PF03098 | 6.5 | IC50 | ChEMBL;BindingDB |
| P42330 | AKR1C3 | Homo sapiens | Human | PF00248 | 6.4 | IC50 | ChEMBL;BindingDB |
| Q04828 | AKR1C1 | Homo sapiens | Human | PF00248 | 6.1 | Ki | ChEMBL;BindingDB |
| P05164 | MPO | Homo sapiens | Human | PF03098 | 6.0 | IC50 | ChEMBL;BindingDB |
DrugBank Target Actions (10)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P02768 | ALB | Albumin | binder | carriers |
| O60656 | O60656 | UDP-glucuronosyltransferase 1A9 | inhibitor | enzymes |
| P05177 | CYP1A2 | Cytochrome P450 1A2 | inhibitor | enzymes |
| P10632 | CYP2C8 | Cytochrome P450 2C8 | inhibitor | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | inhibitor | enzymes |
| P16662 | UGT2B7 | UDP-glucuronosyltransferase 2B7 | inhibitor | enzymes |
| P05177 | CYP1A2 | Cytochrome P450 1A2 | substrate | enzymes |
| P11712 | CYP2C9 | Cytochrome P450 2C9 | substrate | enzymes |
| P23219 | PTGS1 | Prostaglandin G/H synthase 1 | inhibitor | targets |
| P35354 | PTGS2 | Prostaglandin G/H synthase 2 | inhibitor | targets |