Molecule Details
| InChIKey | HXTGXYRHXAGCFP-OAQYLSRUSA-N |
|---|---|
| Compound Name | (+)-alpha-(2,3-Dimethoxyphenyl)-1-(2-(4-fluorophenyl)ethyl)-4-piperidinemethanol |
| Canonical SMILES | COc1cccc([C@H](O)C2CCN(CCc3ccc(F)cc3)CC2)c1OC |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 7 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.06 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16351 |
|---|---|
| Drug Name | Volinanserin |
| CAS Number | 139290-65-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Volinanserin is under investigation in clinical trial NCT00464243 (Efficacy and Safety of Volinanserin on Sleep Maintenance Insomnia - Polysomnographic Study). |
Categories: Antidepressive Agents Benzene Derivatives Central Nervous System Depressants Hydrocarbons, Fluorinated Hydrocarbons, Halogenated Neurotransmitter Agents Serotonin 5-HT2 Receptor Antagonists Serotonin 5-HT2A Receptor Antagonists Serotonin Agents Serotonin Receptor Antagonists
Cross-references: CHEMBL74355 ChemSpider: 4470782 Wikipedia: Volinanserin ZINC: ZINC000000598040
Target Activities (7)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P28223 | HTR2A | Homo sapiens | Human | PF00001 | 9.5 | Ki | ChEMBL;BindingDB |
| P28335 | HTR2C | Homo sapiens | Human | PF00001 | 7.9 | Ki | ChEMBL;BindingDB |
| P41145 | OPRK1 | Homo sapiens | Human | PF00001 | 7.0 | Ki | ChEMBL |
| Q5BJF2 | TMEM97 | Homo sapiens | Human | PF05241 | 6.7 | Ki | ChEMBL |
| P21917 | DRD4 | Homo sapiens | Human | PF00001 | 6.3 | Ki | BindingDB |
| P21728 | DRD1 | Homo sapiens | Human | PF00001 | 6.1 | Ki | ChEMBL |
| P35367 | HRH1 | Homo sapiens | Human | PF00001 | 6.0 | Ki | ChEMBL;BindingDB |