Molecule Details
| InChIKey | HXCNRYXBZNHDNE-UHFFFAOYSA-N |
|---|---|
| Compound Name | Pirenperone |
| Canonical SMILES | Cc1nc2ccccn2c(=O)c1CCN1CCC(C(=O)c2ccc(F)cc2)CC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.9 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB21405 |
|---|---|
| Drug Name | Pirenperone |
| CAS Number | 75444-65-4 |
| Groups | experimental |
| ATC Codes | nan |
| Description | Pirenperone is a small molecule drug. The usage of the INN stem '-perone' in the name indicates that Pirenperone is a tranquillizer, neuroleptic, 4'-fluoro-4-piperidinobutyrophenone derivative. Pirenperone has a monoisotopic molecular weight of 393.19 Da. |
Categories: Central Nervous System Agents Central Nervous System Depressants Psychotropic Drugs Tranquilizing Agents
Cross-references: BindingDB: 50024205 ChEBI: 92444 CHEMBL18331 ZINC: ZINC000000538194
Target Activities (4)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P34969 | HTR7 | 5-hydroxytryptamine receptor 7 | antagonist | targets |