Molecule Details
| InChIKey | HWJPWWYTGBZDEG-UHFFFAOYSA-N |
|---|---|
| Compound Name | Iclaprim |
| Canonical SMILES | COc1cc(Cc2cnc(N)nc2N)c2c(c1OC)OC(C1CC1)C=C2 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 7.38 |
| Source | ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB06358 |
|---|---|
| Drug Name | Iclaprim |
| CAS Number | 192314-93-5 |
| Groups | investigational |
| ATC Codes | J01EA03 |
| Description | nan |
Categories: Antibacterials for Systemic Use Antiinfectives for Systemic Use Enzyme Inhibitors Folic Acid Antagonists Sulfonamides and trimethoprim Trimethoprim and Derivatives
Cross-references: BindingDB: 18070 ChEBI: 131751 CHEMBL134561 ChemSpider: 184736 Wikipedia: Iclaprim