Molecule Details
| InChIKey | HVRWZFQFSQUILC-UHFFFAOYSA-N |
|---|---|
| Compound Name | Unii-XX8E5WP7FS |
| Canonical SMILES | COc1ccc(COc2ccc(Cn3c(N)nc4cc(-c5cnn(C)c5)cnc43)cc2OC)cc1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 4 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 9.38 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB16056 |
|---|---|
| Drug Name | GZ-389988 |
| CAS Number | 1788906-96-6 |
| Groups | investigational |
| ATC Codes | nan |
| Description | GZ-389988 is under investigation in clinical trial NCT02845271 (Proof-of-concept Study to Assess the Efficacy, Tolerability and Safety of a Single Intraarticular Dose of GZ389988 Versus Placebo in Patients With Painful Osteoarthritis of the Knee). |
Cross-references: BindingDB: 164901 CHEMBL3673452 ChemSpider: 58937169 ZINC: ZINC000473215300
Target Activities (4)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q16620 | NTRK2 | Homo sapiens | Human | PF07679 PF13855 PF16920 PF01462 PF07714 | 10.0 | IC50 | ChEMBL;BindingDB |
| P04629 | NTRK1 | Homo sapiens | Human | PF13855 PF16920 PF07714 PF18613 | 9.5 | IC50 | ChEMBL;BindingDB |
| Q16288 | NTRK3 | Homo sapiens | Human | PF07679 PF00047 PF13855 PF16920 PF01462 PF07714 | 9.3 | IC50 | ChEMBL;BindingDB |
| P07333 | CSF1R | Homo sapiens | Human | PF00047 PF25305 PF07714 | 8.7 | IC50 | ChEMBL;BindingDB |