Molecule Details
| InChIKey | HSWPZIDYAHLZDD-UHFFFAOYSA-N |
|---|---|
| Compound Name | Atipamezole |
| Canonical SMILES | CCC1(c2cnc[nH]2)Cc2ccccc2C1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.59 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB11481 |
|---|---|
| Drug Name | Atipamezole |
| CAS Number | 104054-27-5 |
| Groups | investigational vet_approved |
| ATC Codes | nan |
| Description | Atipamezole is a synthetic α2 adrenoceptor antagonistused to reverse the sedative and analgesic effects of dexmedetomidine and medetomidine in dogs. It has also been undergone research as a potential anti-Parkinsonian drug for humans. |
Categories: Adrenergic Agents Adrenergic Antagonists Adrenergic alpha-2 Receptor Antagonists Adrenergic alpha-Antagonists Agents that produce hypertension Neurotransmitter Agents
Cross-references: BindingDB: 81807 CHEMBL353972 ChemSpider: 64427 Drugs Product Database (DPD): 11767 D03002 RxCUI: 18475 Wikipedia: Atipamezole ZINC: ZINC000005424171