Molecule Details
| InChIKey | HQIRNZOQPUAHHV-UHFFFAOYSA-N |
|---|---|
| Compound Name | Bupranolol |
| Canonical SMILES | Cc1ccc(Cl)c(OCC(O)CNC(C)(C)C)c1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 3 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 8.47 |
| Source | BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB08808 |
|---|---|
| Drug Name | Bupranolol |
| CAS Number | 14556-46-8 |
| Groups | experimental |
| ATC Codes | C07AA19 |
| Description | Bupranolol is a non-selective beta blocker with potency similar to [propanolol]. It does not have intrinsic sympathomimetic activity (ISA), but does have strong membrane stabilizing activity. |
Categories: Adrenergic Agents Adrenergic Antagonists Adrenergic beta-Antagonists Agents causing hyperkalemia Alcohols Amines Amino Alcohols Antiarrhythmic agents Antihypertensive Agents Beta Blocking Agents, Non-Selective Bradycardia-Causing Agents Cardiovascular Agents Cytochrome P-450 CYP2D6 Substrates Cytochrome P-450 Substrates Neurotransmitter Agents Phenoxypropanolamines Potential QTc-Prolonging Agents Propanolamines Propanols QTc Prolonging Agents
Cross-references: BindingDB: 25765 ChEBI: 135123 CHEMBL305380 ChemSpider: 2381 Guide to Pharmacology: 550 IUPHAR: 550 D07590 PharmGKB: PA165958426 PubChem:2475 PubChem:99445278 RxCUI: 1817 Wikipedia: Bupranolol