Molecule Details
| InChIKey | HMHVCUVYZFYAJI-UHFFFAOYSA-N |
|---|---|
| Compound Name | Sulthiame |
| Canonical SMILES | NS(=O)(=O)c1ccc(N2CCCCS2(=O)=O)cc1 |
| Clinical Status | Clinical Multi-Target |
| Targets (Human+Pathogen) | 12 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 7.14 |
| Source | BindingDB;ChEMBL;TTD_MultiTarget |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB08329 |
|---|---|
| Drug Name | Sulthiame |
| CAS Number | 61-56-3 |
| Groups | approved |
| ATC Codes | N03AX03 G01AE10 |
| Description | nan |
Categories: Amides Anticonvulsants Benzene Derivatives Central Nervous System Agents Central Nervous System Depressants Genito Urinary System and Sex Hormones Gynecological Antiinfectives and Antiseptics Nervous System Sulfonamides Sulfones Sulfur Compounds
Cross-references: BindingDB: 26999 ChEBI: 32171 CHEMBL328560 ChemSpider: 5163 PDB: OSP PubChem:5356 PubChem:99444800 RxCUI: 10240 Wikipedia: Sultiame ZINC: ZINC000000002119
Target Activities (12)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| P43166 | CA7 | Homo sapiens | Human | PF00194 | 8.2 | Ki | BindingDB |
| P00918 | CA2 | Homo sapiens | Human | PF00194 | 8.1 | Ki | ChEMBL;BindingDB |
| P18505 | GABRB1 | Homo sapiens | Human | PF02931 PF02932 | 8.1 | pIC50 | TTD_MultiTarget |
| Q16790 | CA9 | Homo sapiens | Human | PF00194 | 7.4 | Ki | ChEMBL;BindingDB |
| O43570 | CA12 | Homo sapiens | Human | PF00194 | 7.2 | Ki | BindingDB |
| P35218 | CA5A | Homo sapiens | Human | PF00194 | 7.1 | Ki | BindingDB |
| Q9Y2D0 | CA5B | Homo sapiens | Human | PF00194 | 7.0 | Ki | BindingDB |
| P22748 | CA4 | Homo sapiens | Human | PF00194 | 7.0 | Ki | BindingDB |
| P23280 | CA6 | Homo sapiens | Human | PF00194 | 6.9 | Ki | ChEMBL;BindingDB |
| P00915 | CA1 | Homo sapiens | Human | PF00194 | 6.4 | Ki | ChEMBL;BindingDB |
| P9WPJ9 | mtcA2 | Mycobacterium tuberculosis (strain ATCC 25618 / H37Rv) | Pathogen | PF00484 | 6.2 | Ki | ChEMBL;BindingDB |
| Q3I4V7 | CAN2 | Cryptococcus neoformans | Pathogen | PF00484 | 6.0 | Ki | BindingDB |
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P00915 | CA1 | Carbonic anhydrase | inhibitor | targets |