Molecule Details
| InChIKey | HKEAFJYKMMKDOR-VPRICQMDSA-N |
|---|---|
| Canonical SMILES | O=c1c(-c2ccc(O)cc2)coc2c([C@@H]3O[C@H](CO)[C@@H](O)[C@H](O)[C@H]3O)c(O)ccc12 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 2 |
| Pfam Stratification | Homologous |
| Avg pChEMBL | 6.31 |
| Source | ChEMBL;BindingDB |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB12290 |
|---|---|
| Drug Name | Puerarin |
| CAS Number | 3681-99-0 |
| Groups | investigational |
| ATC Codes | nan |
| Description | Puerarin has been investigated for the treatment of Alcohol Abuse. |
Categories: Benzopyrans Cardiovascular Agents Chromones Flavonoids Heterocyclic Compounds, Fused-Ring Pyrans Vasodilating Agents
Cross-references: BindingDB: 50129558 ChEBI: 8633 CHEMBL486386 ChemSpider: 4445119 C10524 PDB: A1H6W PubChem:5281807 PubChem:347828558 RxCUI: 34975 Wikipedia: Puerarin ZINC: ZINC000004098745
Target Activities (2)
DrugBank Target Actions (1)
| Target | Gene | Target Name | Action | Type |
|---|---|---|---|---|
| P28335 | HTR2C | 5-hydroxytryptamine receptor 2C | modulator | targets |