Molecule Details
| InChIKey | HJORMJIFDVBMOB-LBPRGKRZSA-N |
|---|---|
| Compound Name | (-)-Rolipram |
| Canonical SMILES | COc1ccc([C@@H]2CNC(=O)C2)cc1OC1CCCC1 |
| Clinical Status | Data-mined Candidate |
| Targets (Human+Pathogen) | 6 |
| Pfam Stratification | Cross-Family |
| Avg pChEMBL | 6.61 |
| Source | BindingDB;ChEMBL |
2D Structure
Activity Profile
DrugBank Annotations
| DrugBank ID | DB04149 |
|---|---|
| Drug Name | (R)-Rolipram |
| CAS Number | 85416-75-7 |
| Groups | investigational |
| ATC Codes | nan |
| Description | The (R)-enantiomer of rolipram, it is a phosphodiesterase inhibitor with antidepressant properties. |
Cross-references: BindingDB: 50042058 ChEBI: 40133 CHEMBL430893 ChemSpider: 394978 PDB: ROL PharmGKB: PA153906323 PubChem:448055 PubChem:46507909 Therapeutic Targets Database: DNC000014 ZINC: ZINC000000004982
Target Activities (6)
| Target | Gene | Organism | Category | Pfam | pChEMBL | Type | Source |
|---|---|---|---|---|---|---|---|
| Q08493 | PDE4C | Homo sapiens | Human | PF18100 PF00233 | 7.1 | IC50 | ChEMBL;BindingDB |
| P27815 | PDE4A | Homo sapiens | Human | PF18100 PF00233 | 6.8 | IC50 | ChEMBL;BindingDB |
| Q07343 | PDE4B | Homo sapiens | Human | PF18100 PF00233 | 6.6 | IC50 | ChEMBL;BindingDB |
| P01375 | TNF | Homo sapiens | Human | PF00229 | 6.5 | IC50 | BindingDB |
| Q08499 | PDE4D | Homo sapiens | Human | PF18100 PF00233 | 6.5 | IC50 | ChEMBL;BindingDB |
| O76074 | PDE5A | Homo sapiens | Human | PF01590 PF00233 | 6.1 | IC50 | BindingDB |